C26H21F5N3O6- — CID 162568060
(NZ)-N-[amino-[4-[[[2-[2,6-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]-2-ethoxyacetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 162568060) has the molecular formula C26H21F5N3O6- and a molecular weight of 566.46 g/mol. Its IUPAC name is (NZ)-N-[amino-[4-[[[2-[2,6-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]-2-ethoxyacetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | (NZ)-N-[amino-[4-[[[2-[2,6-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]-2-ethoxyacetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 162568060 |
| Molecular Formula | C26H21F5N3O6- |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | (NZ)-N-[amino-[4-[[[2-[2,6-difluoro-4-[3-(trifluoromethoxy)phenoxy]phenyl]-2-ethoxyacetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CCOC(C(=O)NCc1ccc(/C(N)=N/C(=O)[O-])cc1)c1c(F)cc(Oc2cccc(OC(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C26H22F5N3O6/c1-2-38-22(24(35)33-13-14-6-8-15(9-7-14)23(32)34-25(36)37)21-19(27)11-18(12-20(21)28)39-16-4-3-5-17(10-16)40-26(29,30)31/h3-12,22H,2,13H2,1H3,(H2,32,34)(H,33,35)(H,36,37)/p-1 |
| InChIKey | RXNBEOJDKDTDGY-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|