C25H26FN3O3 — CID 69289996
(2S)-N-[(4-carbamimidoyl-2-phenylphenyl)methyl]-2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetamide (PubChem CID 69289996) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoyl-2-phenylphenyl)methyl]-2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetamide.
| Compound Name | (2S)-N-[(4-carbamimidoyl-2-phenylphenyl)methyl]-2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 69289996 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (2S)-N-[(4-carbamimidoyl-2-phenylphenyl)methyl]-2-ethoxy-2-(2-fluoro-4-methoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OCC)c2ccc(OC)cc2F)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H26FN3O3/c1-3-32-23(20-12-11-19(31-2)14-22(20)26)25(30)29-15-18-10-9-17(24(27)28)13-21(18)16-7-5-4-6-8-16/h4-14,23H,3,15H2,1-2H3,(H3,27,28)(H,29,30)/t23-/m0/s1 |
| InChIKey | JJSYFRFOOATKJH-QHCPKHFHSA-N |
| XLogP | 4.18 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|