C21H24F2N4O5 — CID 69290122
(2S)-N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide (PubChem CID 69290122) has the molecular formula C21H24F2N4O5 and a molecular weight of 450.44 g/mol. Its IUPAC name is (2S)-N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide.
| Compound Name | (2S)-N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 69290122 |
| Molecular Formula | C21H24F2N4O5 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (2S)-N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2-(2,6-difluoro-4-methoxyphenyl)-2-methoxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](OC)c2c(F)cc(OC)cc2F)c(OCC(=O)NC)c1 |
| InChI | InChI=1S/C21H24F2N4O5/c1-26-17(28)10-32-16-6-11(20(24)25)4-5-12(16)9-27-21(29)19(31-3)18-14(22)7-13(30-2)8-15(18)23/h4-8,19H,9-10H2,1-3H3,(H3,24,25)(H,26,28)(H,27,29)/t19-/m0/s1 |
| InChIKey | XPOPDZYEORGIJK-IBGZPJMESA-N |
| XLogP | 1.39 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|