C19H20ClFN4O3 — CID 143196880
N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-4-fluoro-5-methylbenzamide (PubChem CID 143196880) has the molecular formula C19H20ClFN4O3 and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-4-fluoro-5-methylbenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-4-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 143196880 |
| Molecular Formula | C19H20ClFN4O3 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-4-fluoro-5-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(C)c(F)c(Cl)c2)c(OCC(=O)NC)c1 |
| InChI | InChI=1S/C19H20ClFN4O3/c1-10-5-13(6-14(20)17(10)21)19(27)25-8-12-4-3-11(18(22)23)7-15(12)28-9-16(26)24-2/h3-7H,8-9H2,1-2H3,(H3,22,23)(H,24,26)(H,25,27) |
| InChIKey | RJGIIWKSCYAHAF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|