C19H23FN4O4S — CID 11662561
N-[[4-carbamimidoyl-2-[2-(methanesulfonamido)ethoxy]phenyl]methyl]-4-fluoro-3-methylbenzamide (PubChem CID 11662561) has the molecular formula C19H23FN4O4S and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[2-(methanesulfonamido)ethoxy]phenyl]methyl]-4-fluoro-3-methylbenzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[2-(methanesulfonamido)ethoxy]phenyl]methyl]-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 11662561 |
| Molecular Formula | C19H23FN4O4S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[2-(methanesulfonamido)ethoxy]phenyl]methyl]-4-fluoro-3-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccc(F)c(C)c2)c(OCCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H23FN4O4S/c1-12-9-14(5-6-16(12)20)19(25)23-11-15-4-3-13(18(21)22)10-17(15)28-8-7-24-29(2,26)27/h3-6,9-10,24H,7-8,11H2,1-2H3,(H3,21,22)(H,23,25) |
| InChIKey | QOVMLCOETKGJKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|