C17H14ClFN4O3 — CID 58654038
3-amino-N-[[2-(2-amino-2-oxoethoxy)-4-cyanophenyl]methyl]-5-chloro-4-fluorobenzamide (PubChem CID 58654038) has the molecular formula C17H14ClFN4O3 and a molecular weight of 376.78 g/mol. Its IUPAC name is 3-amino-N-[[2-(2-amino-2-oxoethoxy)-4-cyanophenyl]methyl]-5-chloro-4-fluorobenzamide.
| Compound Name | 3-amino-N-[[2-(2-amino-2-oxoethoxy)-4-cyanophenyl]methyl]-5-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 58654038 |
| Molecular Formula | C17H14ClFN4O3 |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-amino-N-[[2-(2-amino-2-oxoethoxy)-4-cyanophenyl]methyl]-5-chloro-4-fluorobenzamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cc(N)c(F)c(Cl)c2)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C17H14ClFN4O3/c18-12-4-11(5-13(21)16(12)19)17(25)23-7-10-2-1-9(6-20)3-14(10)26-8-15(22)24/h1-5H,7-8,21H2,(H2,22,24)(H,23,25) |
| InChIKey | CMQAIXUIEFLIFC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|