C18H14ClF2N3O3 — CID 58653945
3-chloro-N-[[4-cyano-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2,4-difluorobenzamide (PubChem CID 58653945) has the molecular formula C18H14ClF2N3O3 and a molecular weight of 393.78 g/mol. Its IUPAC name is 3-chloro-N-[[4-cyano-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2,4-difluorobenzamide.
| Compound Name | 3-chloro-N-[[4-cyano-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 58653945 |
| Molecular Formula | C18H14ClF2N3O3 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-chloro-N-[[4-cyano-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-2,4-difluorobenzamide |
| SMILES | CNC(=O)COc1cc(C#N)ccc1CNC(=O)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C18H14ClF2N3O3/c1-23-15(25)9-27-14-6-10(7-22)2-3-11(14)8-24-18(26)12-4-5-13(20)16(19)17(12)21/h2-6H,8-9H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | QHWJAAXFKFYFFX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|