C24H24Cl2N4O4 — CID 69346698
N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-5-hydroxy-N-phenylbenzamide;hydrochloride (PubChem CID 69346698) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-5-hydroxy-N-phenylbenzamide;hydrochloride.
| Compound Name | N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-5-hydroxy-N-phenylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 69346698 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[2-(methylamino)-2-oxoethoxy]phenyl]methyl]-3-chloro-5-hydroxy-N-phenylbenzamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CN(C(=O)c2cc(O)cc(Cl)c2)c2ccccc2)c(OCC(=O)NC)c1 |
| InChI | InChI=1S/C24H23ClN4O4.ClH/c1-28-22(31)14-33-21-11-15(23(26)27)7-8-16(21)13-29(19-5-3-2-4-6-19)24(32)17-9-18(25)12-20(30)10-17;/h2-12,30H,13-14H2,1H3,(H3,26,27)(H,28,31);1H |
| InChIKey | XYEIGKJAAUSWCY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|