C24H24ClN5O2 — CID 69342759
4-[[2-[(N-acetyl-3-chloroanilino)methyl]-5-carbamimidoylanilino]methyl]benzamide (PubChem CID 69342759) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 4-[[2-[(N-acetyl-3-chloroanilino)methyl]-5-carbamimidoylanilino]methyl]benzamide.
| Compound Name | 4-[[2-[(N-acetyl-3-chloroanilino)methyl]-5-carbamimidoylanilino]methyl]benzamide |
|---|---|
| PubChem CID | 69342759 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 4-[[2-[(N-acetyl-3-chloroanilino)methyl]-5-carbamimidoylanilino]methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(C(C)=O)c2cccc(Cl)c2)c(NCc2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C24H24ClN5O2/c1-15(31)30(21-4-2-3-20(25)12-21)14-19-10-9-18(23(26)27)11-22(19)29-13-16-5-7-17(8-6-16)24(28)32/h2-12,29H,13-14H2,1H3,(H3,26,27)(H2,28,32) |
| InChIKey | UNPYGFUKTBAJCN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|