C26H27ClFN5O2 — CID 58653912
N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-3-chloro-5-(2-methylpropanoylamino)benzamide (PubChem CID 58653912) has the molecular formula C26H27ClFN5O2 and a molecular weight of 495.99 g/mol. Its IUPAC name is N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-3-chloro-5-(2-methylpropanoylamino)benzamide.
| Compound Name | N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-3-chloro-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 58653912 |
| Molecular Formula | C26H27ClFN5O2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[[4-carbamimidoyl-2-[(2-fluorophenyl)methylamino]phenyl]methyl]-3-chloro-5-(2-methylpropanoylamino)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cc(Cl)cc(NC(=O)C(C)C)c2)c(NCc2ccccc2F)c1 |
| InChI | InChI=1S/C26H27ClFN5O2/c1-15(2)25(34)33-21-10-19(9-20(27)12-21)26(35)32-14-18-8-7-16(24(29)30)11-23(18)31-13-17-5-3-4-6-22(17)28/h3-12,15,31H,13-14H2,1-2H3,(H3,29,30)(H,32,35)(H,33,34) |
| InChIKey | YQBCDMDDZSHIJH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|