C26H29ClFN5O2 — CID 10163842
2-[2-(3-aminophenyl)-3-chloro-6-hydroxy-5-(2-methylpropylamino)phenyl]-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]acetamide (PubChem CID 10163842) has the molecular formula C26H29ClFN5O2 and a molecular weight of 498.00 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)-3-chloro-6-hydroxy-5-(2-methylpropylamino)phenyl]-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[2-(3-aminophenyl)-3-chloro-6-hydroxy-5-(2-methylpropylamino)phenyl]-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10163842 |
| Molecular Formula | C26H29ClFN5O2 |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[2-(3-aminophenyl)-3-chloro-6-hydroxy-5-(2-methylpropylamino)phenyl]-N-[(4-carbamimidoyl-2-fluorophenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(O)c(NCC(C)C)cc(Cl)c2-c2cccc(N)c2)c(F)c1 |
| InChI | InChI=1S/C26H29ClFN5O2/c1-14(2)12-32-22-11-20(27)24(15-4-3-5-18(29)8-15)19(25(22)35)10-23(34)33-13-17-7-6-16(26(30)31)9-21(17)28/h3-9,11,14,32,35H,10,12-13,29H2,1-2H3,(H3,30,31)(H,33,34) |
| InChIKey | HCTPRSRTNDAXBA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|