C29H28Cl2N6O2 — CID 10166575
2-[3-(3-aminophenyl)-4-chloro-6-[2-(3-chlorophenyl)ethylimino]-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 10166575) has the molecular formula C29H28Cl2N6O2 and a molecular weight of 563.49 g/mol. Its IUPAC name is 2-[3-(3-aminophenyl)-4-chloro-6-[2-(3-chlorophenyl)ethylimino]-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[3-(3-aminophenyl)-4-chloro-6-[2-(3-chlorophenyl)ethylimino]-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10166575 |
| Molecular Formula | C29H28Cl2N6O2 |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 2-[3-(3-aminophenyl)-4-chloro-6-[2-(3-chlorophenyl)ethylimino]-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(-c3cccc(N)c3)c(Cl)c/c(=N\CCc3cccc(Cl)c3)n2O)cc1 |
| InChI | InChI=1S/C29H28Cl2N6O2/c30-22-5-1-3-18(13-22)11-12-35-26-15-24(31)28(21-4-2-6-23(32)14-21)25(37(26)39)16-27(38)36-17-19-7-9-20(10-8-19)29(33)34/h1-10,13-15,39H,11-12,16-17,32H2,(H3,33,34)(H,36,38)/b35-26+ |
| InChIKey | VQMYNUHIWDFRTB-MDAYZVFASA-N |
| XLogP | 4.57 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|