C26H29ClN6O2 — CID 10185022
2-[3-(3-aminophenyl)-4-chloro-6-cyclopentylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 10185022) has the molecular formula C26H29ClN6O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 2-[3-(3-aminophenyl)-4-chloro-6-cyclopentylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[3-(3-aminophenyl)-4-chloro-6-cyclopentylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10185022 |
| Molecular Formula | C26H29ClN6O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-[3-(3-aminophenyl)-4-chloro-6-cyclopentylimino-1-hydroxy-2-pyridinyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(-c3cccc(N)c3)c(Cl)c/c(=N\C3CCCC3)n2O)cc1 |
| InChI | InChI=1S/C26H29ClN6O2/c27-21-13-23(32-20-6-1-2-7-20)33(35)22(25(21)18-4-3-5-19(28)12-18)14-24(34)31-15-16-8-10-17(11-9-16)26(29)30/h3-5,8-13,20,35H,1-2,6-7,14-15,28H2,(H3,29,30)(H,31,34)/b32-23+ |
| InChIKey | TYONHDZRPPVFQE-AWSUPERCSA-N |
| XLogP | 3.61 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|