C24H24ClF3N6O2 — CID 10186357
N-[(4-carbamimidoylphenyl)methyl]-2-[3-chloro-2-(3,5-diaminophenyl)-6-hydroxy-5-(2,2,2-trifluoroethylamino)phenyl]acetamide (PubChem CID 10186357) has the molecular formula C24H24ClF3N6O2 and a molecular weight of 520.94 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[3-chloro-2-(3,5-diaminophenyl)-6-hydroxy-5-(2,2,2-trifluoroethylamino)phenyl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-chloro-2-(3,5-diaminophenyl)-6-hydroxy-5-(2,2,2-trifluoroethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 10186357 |
| Molecular Formula | C24H24ClF3N6O2 |
| Molecular Weight | 520.94 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-chloro-2-(3,5-diaminophenyl)-6-hydroxy-5-(2,2,2-trifluoroethylamino)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cc2c(O)c(NCC(F)(F)F)cc(Cl)c2-c2cc(N)cc(N)c2)cc1 |
| InChI | InChI=1S/C24H24ClF3N6O2/c25-18-9-19(34-11-24(26,27)28)22(36)17(21(18)14-5-15(29)7-16(30)6-14)8-20(35)33-10-12-1-3-13(4-2-12)23(31)32/h1-7,9,34,36H,8,10-11,29-30H2,(H3,31,32)(H,33,35) |
| InChIKey | DSWJWCGFOARQLQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.94 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|