C23H25ClN4O4S — CID 45263360
2-[3-(benzenesulfonamido)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride (PubChem CID 45263360) has the molecular formula C23H25ClN4O4S and a molecular weight of 489.00 g/mol. Its IUPAC name is 2-[3-(benzenesulfonamido)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-[3-(benzenesulfonamido)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45263360 |
| Molecular Formula | C23H25ClN4O4S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[3-(benzenesulfonamido)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)Cc2c(C)ccc(NS(=O)(=O)c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C23H24N4O4S.ClH/c1-15-7-12-20(27-32(30,31)18-5-3-2-4-6-18)22(29)19(15)13-21(28)26-14-16-8-10-17(11-9-16)23(24)25;/h2-12,27,29H,13-14H2,1H3,(H3,24,25)(H,26,28);1H |
| InChIKey | IFXVVVFEPQYNOV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|