C22H22Cl3N5O4S — CID 45263670
N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3,4-dichlorophenyl)sulfonylamino]-4-methyl-2-oxo-3-pyridinyl]acetamide;hydrochloride (PubChem CID 45263670) has the molecular formula C22H22Cl3N5O4S and a molecular weight of 558.88 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3,4-dichlorophenyl)sulfonylamino]-4-methyl-2-oxo-3-pyridinyl]acetamide;hydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3,4-dichlorophenyl)sulfonylamino]-4-methyl-2-oxo-3-pyridinyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45263670 |
| Molecular Formula | C22H22Cl3N5O4S |
| Molecular Weight | 558.88 g/mol |
| Exact Mass | 557.05 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[1-[(3,4-dichlorophenyl)sulfonylamino]-4-methyl-2-oxo-3-pyridinyl]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)Cc2c(C)ccn(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2=O)cc1 |
| InChI | InChI=1S/C22H21Cl2N5O4S.ClH/c1-13-8-9-29(28-34(32,33)16-6-7-18(23)19(24)10-16)22(31)17(13)11-20(30)27-12-14-2-4-15(5-3-14)21(25)26;/h2-10,28H,11-12H2,1H3,(H3,25,26)(H,27,30);1H |
| InChIKey | NUEJKIPBVUOKLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.88 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|