C24H27ClN4O4S — CID 45263335
2-[3-(benzenesulfonylmethylamino)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride (PubChem CID 45263335) has the molecular formula C24H27ClN4O4S and a molecular weight of 503.02 g/mol. Its IUPAC name is 2-[3-(benzenesulfonylmethylamino)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-[3-(benzenesulfonylmethylamino)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45263335 |
| Molecular Formula | C24H27ClN4O4S |
| Molecular Weight | 503.02 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-[3-(benzenesulfonylmethylamino)-2-hydroxy-6-methylphenyl]-N-[(4-carbamimidoylphenyl)methyl]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)Cc2c(C)ccc(NCS(=O)(=O)c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C24H26N4O4S.ClH/c1-16-7-12-21(28-15-33(31,32)19-5-3-2-4-6-19)23(30)20(16)13-22(29)27-14-17-8-10-18(11-9-17)24(25)26;/h2-12,28,30H,13-15H2,1H3,(H3,25,26)(H,27,29);1H |
| InChIKey | PBEKRIQGBBNTDR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.02 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|