C24H28ClN5O2 — CID 45263667
N-[(4-carbamimidoylphenyl)methyl]-2-[4-methyl-2-oxo-1-(2-phenylethylamino)-3-pyridinyl]acetamide;hydrochloride (PubChem CID 45263667) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[4-methyl-2-oxo-1-(2-phenylethylamino)-3-pyridinyl]acetamide;hydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-methyl-2-oxo-1-(2-phenylethylamino)-3-pyridinyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 45263667 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[4-methyl-2-oxo-1-(2-phenylethylamino)-3-pyridinyl]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)Cc2c(C)ccn(NCCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C24H27N5O2.ClH/c1-17-12-14-29(28-13-11-18-5-3-2-4-6-18)24(31)21(17)15-22(30)27-16-19-7-9-20(10-8-19)23(25)26;/h2-10,12,14,28H,11,13,15-16H2,1H3,(H3,25,26)(H,27,30);1H |
| InChIKey | GPNYTCMCOURFRN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|