C34H31N5O6S — CID 140516934
benzyl N-[4-[[[2-[4-methyl-1-(naphthalen-1-ylsulfonylamino)-2-oxo-3-pyridinyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 140516934) has the molecular formula C34H31N5O6S and a molecular weight of 637.72 g/mol. Its IUPAC name is benzyl N-[4-[[[2-[4-methyl-1-(naphthalen-1-ylsulfonylamino)-2-oxo-3-pyridinyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | benzyl N-[4-[[[2-[4-methyl-1-(naphthalen-1-ylsulfonylamino)-2-oxo-3-pyridinyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 140516934 |
| Molecular Formula | C34H31N5O6S |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | benzyl N-[4-[[[2-[4-methyl-1-(naphthalen-1-ylsulfonylamino)-2-oxo-3-pyridinyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(CNC(=O)Cc2c(C)ccn(NS(=O)(=O)c3cccc4ccccc34)c2=O)cc1 |
| InChI | InChI=1S/C34H31N5O6S/c1-23-18-19-39(38-46(43,44)30-13-7-11-26-10-5-6-12-28(26)30)33(41)29(23)20-31(40)36-21-24-14-16-27(17-15-24)32(35)37-34(42)45-22-25-8-3-2-4-9-25/h2-19,38H,20-22H2,1H3,(H,36,40)(H2,35,37,42) |
| InChIKey | ALJNOYLMYNEXEA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|