C32H35N3O7 — CID 173363274
3-[[2-[4-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]phenyl]acetyl]amino]propanoyloxymethyl 2,2-dimethylpropanoate (PubChem CID 173363274) has the molecular formula C32H35N3O7 and a molecular weight of 573.65 g/mol. Its IUPAC name is 3-[[2-[4-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]phenyl]acetyl]amino]propanoyloxymethyl 2,2-dimethylpropanoate.
| Compound Name | 3-[[2-[4-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]phenyl]acetyl]amino]propanoyloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173363274 |
| Molecular Formula | C32H35N3O7 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 3-[[2-[4-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]phenyl]acetyl]amino]propanoyloxymethyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(-c2ccc(CC(=O)NCCC(=O)OCOC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H35N3O7/c1-32(2,3)30(38)42-21-41-28(37)17-18-34-27(36)19-22-9-11-24(12-10-22)25-13-15-26(16-14-25)29(33)35-31(39)40-20-23-7-5-4-6-8-23/h4-16H,17-21H2,1-3H3,(H,34,36)(H2,33,35,39) |
| InChIKey | ZIOSQCGMBDUMQP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|