C11H14N2O3 — CID 173285751
2-methoxyethyl N-(benzenecarboximidoyl)carbamate (PubChem CID 173285751) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-methoxyethyl N-(benzenecarboximidoyl)carbamate.
| Compound Name | 2-methoxyethyl N-(benzenecarboximidoyl)carbamate |
|---|---|
| PubChem CID | 173285751 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-methoxyethyl N-(benzenecarboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OCCOC)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O3/c1-15-7-8-16-11(14)13-10(12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,12,13,14) |
| InChIKey | AFIPHYYZKSZPHR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|