C13H19N3O4 — CID 156546254
2-(2-methoxyethoxy)ethyl N-(4-aminobenzenecarboximidoyl)carbamate (PubChem CID 156546254) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-(4-aminobenzenecarboximidoyl)carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-(4-aminobenzenecarboximidoyl)carbamate |
|---|---|
| PubChem CID | 156546254 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-(4-aminobenzenecarboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OCCOCCOC)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H19N3O4/c1-18-6-7-19-8-9-20-13(17)16-12(15)10-2-4-11(14)5-3-10/h2-5H,6-9,14H2,1H3,(H2,15,16,17) |
| InChIKey | LVXULKYDWKJYSM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|