C14H19N3O4 — CID 142339502
1-[(4-aminobenzenecarboximidoyl)carbamoyloxy]ethyl 2-methylpropanoate (PubChem CID 142339502) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[(4-aminobenzenecarboximidoyl)carbamoyloxy]ethyl 2-methylpropanoate.
| Compound Name | 1-[(4-aminobenzenecarboximidoyl)carbamoyloxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 142339502 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[(4-aminobenzenecarboximidoyl)carbamoyloxy]ethyl 2-methylpropanoate |
| SMILES | [H]/N=C(\NC(=O)OC(C)OC(=O)C(C)C)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H19N3O4/c1-8(2)13(18)20-9(3)21-14(19)17-12(16)10-4-6-11(15)7-5-10/h4-9H,15H2,1-3H3,(H2,16,17,19) |
| InChIKey | RXTIDERBRZXTPR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|