C12H17N3O3 — CID 142339408
2-ethoxyethyl N-(4-aminobenzenecarboximidoyl)carbamate (PubChem CID 142339408) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-ethoxyethyl N-(4-aminobenzenecarboximidoyl)carbamate.
| Compound Name | 2-ethoxyethyl N-(4-aminobenzenecarboximidoyl)carbamate |
|---|---|
| PubChem CID | 142339408 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-ethoxyethyl N-(4-aminobenzenecarboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OCCOCC)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H17N3O3/c1-2-17-7-8-18-12(16)15-11(14)9-3-5-10(13)6-4-9/h3-6H,2,7-8,13H2,1H3,(H2,14,15,16) |
| InChIKey | QDEITOAKLKBODK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|