C23H27ClN4O5 — CID 156751070
methyl (3R,5S)-5-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylcarbamoyl]pyrrolidine-3-carboxylate;hydrochloride (PubChem CID 156751070) has the molecular formula C23H27ClN4O5 and a molecular weight of 474.95 g/mol. Its IUPAC name is methyl (3R,5S)-5-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylcarbamoyl]pyrrolidine-3-carboxylate;hydrochloride.
| Compound Name | methyl (3R,5S)-5-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylcarbamoyl]pyrrolidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 156751070 |
| Molecular Formula | C23H27ClN4O5 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | methyl (3R,5S)-5-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylcarbamoyl]pyrrolidine-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(CNC(=O)[C@@H]2C[C@@H](C(=O)OC)CN2)cc1 |
| InChI | InChI=1S/C23H26N4O5.ClH/c1-31-22(29)18-11-19(25-13-18)21(28)26-12-15-7-9-17(10-8-15)20(24)27-23(30)32-14-16-5-3-2-4-6-16;/h2-10,18-19,25H,11-14H2,1H3,(H,26,28)(H2,24,27,30);1H/t18-,19+;/m1./s1 |
| InChIKey | XTRVGRMCHRDJIK-VOMIJIAVSA-N |
| XLogP | 2.13 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|