C31H35N5O6S — CID 173179844
benzyl N-[4-[[[2-[6-[(4-methyl-6-oxocyclohexa-1,3-dien-1-yl)methylsulfonylamino]-1,2,3,6-tetrahydropyridin-5-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173179844) has the molecular formula C31H35N5O6S and a molecular weight of 605.72 g/mol. Its IUPAC name is benzyl N-[4-[[[2-[6-[(4-methyl-6-oxocyclohexa-1,3-dien-1-yl)methylsulfonylamino]-1,2,3,6-tetrahydropyridin-5-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | benzyl N-[4-[[[2-[6-[(4-methyl-6-oxocyclohexa-1,3-dien-1-yl)methylsulfonylamino]-1,2,3,6-tetrahydropyridin-5-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173179844 |
| Molecular Formula | C31H35N5O6S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | benzyl N-[4-[[[2-[6-[(4-methyl-6-oxocyclohexa-1,3-dien-1-yl)methylsulfonylamino]-1,2,3,6-tetrahydropyridin-5-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(CNC(=O)CC2=CCCNC2NS(=O)(=O)CC2=CC=C(C)CC2=O)cc1 |
| InChI | InChI=1S/C31H35N5O6S/c1-21-9-12-26(27(37)16-21)20-43(40,41)36-30-25(8-5-15-33-30)17-28(38)34-18-22-10-13-24(14-11-22)29(32)35-31(39)42-19-23-6-3-2-4-7-23/h2-4,6-14,30,33,36H,5,15-20H2,1H3,(H,34,38)(H2,32,35,39) |
| InChIKey | SKELEVWSWGZEHT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|