C27H25N5O5 — CID 173316910
ethyl 2-[1-amino-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)benzoyl]benzimidazol-2-yl]acetate (PubChem CID 173316910) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is ethyl 2-[1-amino-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)benzoyl]benzimidazol-2-yl]acetate.
| Compound Name | ethyl 2-[1-amino-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)benzoyl]benzimidazol-2-yl]acetate |
|---|---|
| PubChem CID | 173316910 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | ethyl 2-[1-amino-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)benzoyl]benzimidazol-2-yl]acetate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(C(=O)c2ccc3c(c2)nc(CC(=O)OCC)n3N)cc1 |
| InChI | InChI=1S/C27H25N5O5/c1-2-36-24(33)15-23-30-21-14-20(12-13-22(21)32(23)29)25(34)18-8-10-19(11-9-18)26(28)31-27(35)37-16-17-6-4-3-5-7-17/h3-14H,2,15-16,29H2,1H3,(H2,28,31,35) |
| InChIKey | RXNZYJNZKNSSJQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|