C27H30N2O6 — CID 177447519
ethyl 5-[6-[N-[(4-methoxyphenyl)methoxycarbonyl]carbamimidoyl]naphthalen-2-yl]oxypentanoate (PubChem CID 177447519) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is ethyl 5-[6-[N-[(4-methoxyphenyl)methoxycarbonyl]carbamimidoyl]naphthalen-2-yl]oxypentanoate.
| Compound Name | ethyl 5-[6-[N-[(4-methoxyphenyl)methoxycarbonyl]carbamimidoyl]naphthalen-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 177447519 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | ethyl 5-[6-[N-[(4-methoxyphenyl)methoxycarbonyl]carbamimidoyl]naphthalen-2-yl]oxypentanoate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccc(OC)cc1)c1ccc2cc(OCCCCC(=O)OCC)ccc2c1 |
| InChI | InChI=1S/C27H30N2O6/c1-3-33-25(30)6-4-5-15-34-24-14-11-20-16-22(10-9-21(20)17-24)26(28)29-27(31)35-18-19-7-12-23(32-2)13-8-19/h7-14,16-17H,3-6,15,18H2,1-2H3,(H2,28,29,31) |
| InChIKey | FZZCMKYUKZTPGE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|