C31H27BrN2O5 — CID 152771225
(4-methoxyphenyl)methyl N-[3-benzoyl-4-[[4-(bromomethyl)phenyl]methoxy]benzenecarboximidoyl]carbamate (PubChem CID 152771225) has the molecular formula C31H27BrN2O5 and a molecular weight of 587.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[3-benzoyl-4-[[4-(bromomethyl)phenyl]methoxy]benzenecarboximidoyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[3-benzoyl-4-[[4-(bromomethyl)phenyl]methoxy]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 152771225 |
| Molecular Formula | C31H27BrN2O5 |
| Molecular Weight | 587.47 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[3-benzoyl-4-[[4-(bromomethyl)phenyl]methoxy]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccc(OC)cc1)c1ccc(OCc2ccc(CBr)cc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H27BrN2O5/c1-37-26-14-11-23(12-15-26)20-39-31(36)34-30(33)25-13-16-28(38-19-22-9-7-21(18-32)8-10-22)27(17-25)29(35)24-5-3-2-4-6-24/h2-17H,18-20H2,1H3,(H2,33,34,36) |
| InChIKey | AYTRIVBZHLWPIY-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|