C32H26N4O8 — CID 152770099
(4-methoxyphenyl)methyl N-[4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-2-nitrophenyl]methoxy]benzenecarboximidoyl]carbamate (PubChem CID 152770099) has the molecular formula C32H26N4O8 and a molecular weight of 594.58 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-2-nitrophenyl]methoxy]benzenecarboximidoyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-2-nitrophenyl]methoxy]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 152770099 |
| Molecular Formula | C32H26N4O8 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-2-nitrophenyl]methoxy]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccc(OC)cc1)c1ccc(OCc2ccc(CN3C(=O)c4ccccc4C3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H26N4O8/c1-42-24-12-7-20(8-13-24)18-44-32(39)34-29(33)22-10-14-25(15-11-22)43-19-23-9-6-21(16-28(23)36(40)41)17-35-30(37)26-4-2-3-5-27(26)31(35)38/h2-16H,17-19H2,1H3,(H2,33,34,39) |
| InChIKey | ZYNZHEKOLJMYEP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|