C17H11N2O7- — CID 7290784
2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxycarbonyl-6-nitrophenolate (PubChem CID 7290784) has the molecular formula C17H11N2O7- and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxycarbonyl-6-nitrophenolate.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxycarbonyl-6-nitrophenolate |
|---|---|
| PubChem CID | 7290784 |
| Molecular Formula | C17H11N2O7- |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxycarbonyl-6-nitrophenolate |
| SMILES | COC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12N2O7/c1-26-17(23)9-6-10(14(20)13(7-9)19(24)25)8-18-15(21)11-4-2-3-5-12(11)16(18)22/h2-7,20H,8H2,1H3/p-1 |
| InChIKey | HAIYABUPJWVPCY-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|