C29H36O5Si — CID 10767460
[2-(methoxymethoxy)-5-[phenylmethoxy-di(propan-2-yl)silyl]phenyl]-(4-methoxyphenyl)methanone (PubChem CID 10767460) has the molecular formula C29H36O5Si and a molecular weight of 492.69 g/mol. Its IUPAC name is [2-(methoxymethoxy)-5-[phenylmethoxy-di(propan-2-yl)silyl]phenyl]-(4-methoxyphenyl)methanone.
| Compound Name | [2-(methoxymethoxy)-5-[phenylmethoxy-di(propan-2-yl)silyl]phenyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10767460 |
| Molecular Formula | C29H36O5Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [2-(methoxymethoxy)-5-[phenylmethoxy-di(propan-2-yl)silyl]phenyl]-(4-methoxyphenyl)methanone |
| SMILES | COCOc1ccc([Si](OCc2ccccc2)(C(C)C)C(C)C)cc1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H36O5Si/c1-21(2)35(22(3)4,34-19-23-10-8-7-9-11-23)26-16-17-28(33-20-31-5)27(18-26)29(30)24-12-14-25(32-6)15-13-24/h7-18,21-22H,19-20H2,1-6H3 |
| InChIKey | AOFJSAFXVWHOOG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|