C33H42O5Si — CID 10650249
1-[2-(4-methoxybenzoyl)-4-[phenylmethoxy-di(propan-2-yl)silyl]phenoxy]-3,3-dimethylbutan-2-one (PubChem CID 10650249) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is 1-[2-(4-methoxybenzoyl)-4-[phenylmethoxy-di(propan-2-yl)silyl]phenoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[2-(4-methoxybenzoyl)-4-[phenylmethoxy-di(propan-2-yl)silyl]phenoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 10650249 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 1-[2-(4-methoxybenzoyl)-4-[phenylmethoxy-di(propan-2-yl)silyl]phenoxy]-3,3-dimethylbutan-2-one |
| SMILES | COc1ccc(C(=O)c2cc([Si](OCc3ccccc3)(C(C)C)C(C)C)ccc2OCC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H42O5Si/c1-23(2)39(24(3)4,38-21-25-12-10-9-11-13-25)28-18-19-30(37-22-31(34)33(5,6)7)29(20-28)32(35)26-14-16-27(36-8)17-15-26/h9-20,23-24H,21-22H2,1-8H3 |
| InChIKey | BKCWUVINGLSUOK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|