C25H37NO4Si — CID 12024008
2-(methoxymethoxy)-N-phenyl-5-[tri(propan-2-yl)silyloxymethyl]benzamide (PubChem CID 12024008) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is 2-(methoxymethoxy)-N-phenyl-5-[tri(propan-2-yl)silyloxymethyl]benzamide.
| Compound Name | 2-(methoxymethoxy)-N-phenyl-5-[tri(propan-2-yl)silyloxymethyl]benzamide |
|---|---|
| PubChem CID | 12024008 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 2-(methoxymethoxy)-N-phenyl-5-[tri(propan-2-yl)silyloxymethyl]benzamide |
| SMILES | COCOc1ccc(CO[Si](C(C)C)(C(C)C)C(C)C)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H37NO4Si/c1-18(2)31(19(3)4,20(5)6)30-16-21-13-14-24(29-17-28-7)23(15-21)25(27)26-22-11-9-8-10-12-22/h8-15,18-20H,16-17H2,1-7H3,(H,26,27) |
| InChIKey | HOZSJVFXVWYCLR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|