C21H18N2O5 — CID 139662112
2-[6-(N-phenylmethoxycarbonylcarbamimidoyl)naphthalen-2-yl]oxyacetic acid (PubChem CID 139662112) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-[6-(N-phenylmethoxycarbonylcarbamimidoyl)naphthalen-2-yl]oxyacetic acid.
| Compound Name | 2-[6-(N-phenylmethoxycarbonylcarbamimidoyl)naphthalen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 139662112 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[6-(N-phenylmethoxycarbonylcarbamimidoyl)naphthalen-2-yl]oxyacetic acid |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc2cc(OCC(=O)O)ccc2c1 |
| InChI | InChI=1S/C21H18N2O5/c22-20(23-21(26)28-12-14-4-2-1-3-5-14)17-7-6-16-11-18(27-13-19(24)25)9-8-15(16)10-17/h1-11H,12-13H2,(H,24,25)(H2,22,23,26) |
| InChIKey | JVCOHWAEZRMEBU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|