C29H32N4O6 — CID 139672023
tert-butyl 2-[4-[[2-[4-(N-phenylmethoxycarbonylcarbamimidoyl)anilino]acetyl]amino]phenoxy]acetate (PubChem CID 139672023) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-[4-(N-phenylmethoxycarbonylcarbamimidoyl)anilino]acetyl]amino]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[2-[4-(N-phenylmethoxycarbonylcarbamimidoyl)anilino]acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 139672023 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | tert-butyl 2-[4-[[2-[4-(N-phenylmethoxycarbonylcarbamimidoyl)anilino]acetyl]amino]phenoxy]acetate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(NCC(=O)Nc2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O6/c1-29(2,3)39-26(35)19-37-24-15-13-23(14-16-24)32-25(34)17-31-22-11-9-21(10-12-22)27(30)33-28(36)38-18-20-7-5-4-6-8-20/h4-16,31H,17-19H2,1-3H3,(H,32,34)(H2,30,33,36) |
| InChIKey | WOLNGQOYJLAICD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|