C23H27NO6 — CID 70192157
tert-butyl 2-(methylamino)-3-oxo-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]propanoate (PubChem CID 70192157) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is tert-butyl 2-(methylamino)-3-oxo-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]propanoate.
| Compound Name | tert-butyl 2-(methylamino)-3-oxo-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 70192157 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | tert-butyl 2-(methylamino)-3-oxo-3-[4-(2-oxo-2-phenylmethoxyethoxy)phenyl]propanoate |
| SMILES | CNC(C(=O)OC(C)(C)C)C(=O)c1ccc(OCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-23(2,3)30-22(27)20(24-4)21(26)17-10-12-18(13-11-17)28-15-19(25)29-14-16-8-6-5-7-9-16/h5-13,20,24H,14-15H2,1-4H3 |
| InChIKey | CFYFYOKWHGDPGG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|