C29H27N3O3 — CID 54840284
3-methyl-N-[4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]phenyl]benzamide (PubChem CID 54840284) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54840284 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 3-methyl-N-[4-[[2-oxo-2-(4-phenylmethoxyanilino)ethyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NCC(=O)Nc3ccc(OCc4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C29H27N3O3/c1-21-6-5-9-23(18-21)29(34)32-26-12-10-24(11-13-26)30-19-28(33)31-25-14-16-27(17-15-25)35-20-22-7-3-2-4-8-22/h2-18,30H,19-20H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | WTLNGNFWGUZEBF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |