C25H27N3O3 — CID 54822485
3-methyl-N-[4-[[2-(4-propan-2-yloxyanilino)acetyl]amino]phenyl]benzamide (PubChem CID 54822485) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-(4-propan-2-yloxyanilino)acetyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-(4-propan-2-yloxyanilino)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54822485 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-methyl-N-[4-[[2-(4-propan-2-yloxyanilino)acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)CNc3ccc(OC(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-17(2)31-23-13-11-20(12-14-23)26-16-24(29)27-21-7-9-22(10-8-21)28-25(30)19-6-4-5-18(3)15-19/h4-15,17,26H,16H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | GBOJMYNMDFAFHH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|