C17H14N2O3 — CID 140970983
benzyl N-(2-benzofuran-5-carboximidoyl)carbamate (PubChem CID 140970983) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is benzyl N-(2-benzofuran-5-carboximidoyl)carbamate.
| Compound Name | benzyl N-(2-benzofuran-5-carboximidoyl)carbamate |
|---|---|
| PubChem CID | 140970983 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | benzyl N-(2-benzofuran-5-carboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc2cocc2c1 |
| InChI | InChI=1S/C17H14N2O3/c18-16(13-6-7-14-10-21-11-15(14)8-13)19-17(20)22-9-12-4-2-1-3-5-12/h1-8,10-11H,9H2,(H2,18,19,20) |
| InChIKey | UIVQUTSMDFVLNV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|