C17H13N3O5 — CID 140970969
3-(N-phenylmethoxycarbonylcarbamimidoyl)furo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 140970969) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 3-(N-phenylmethoxycarbonylcarbamimidoyl)furo[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 3-(N-phenylmethoxycarbonylcarbamimidoyl)furo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 140970969 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-(N-phenylmethoxycarbonylcarbamimidoyl)furo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1c(C(=O)O)oc2ncccc12 |
| InChI | InChI=1S/C17H13N3O5/c18-14(20-17(23)24-9-10-5-2-1-3-6-10)12-11-7-4-8-19-15(11)25-13(12)16(21)22/h1-8H,9H2,(H,21,22)(H2,18,20,23) |
| InChIKey | SUCNCFARCJXLRO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|