C27H26N4O3 — CID 173056770
ethyl N-[4-[[(2-benzyl-1H-indole-3-carbonyl)amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173056770) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is ethyl N-[4-[[(2-benzyl-1H-indole-3-carbonyl)amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | ethyl N-[4-[[(2-benzyl-1H-indole-3-carbonyl)amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173056770 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | ethyl N-[4-[[(2-benzyl-1H-indole-3-carbonyl)amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC)c1ccc(CNC(=O)c2c(Cc3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-2-34-27(33)31-25(28)20-14-12-19(13-15-20)17-29-26(32)24-21-10-6-7-11-22(21)30-23(24)16-18-8-4-3-5-9-18/h3-15,30H,2,16-17H2,1H3,(H,29,32)(H2,28,31,33) |
| InChIKey | BFQRHJBPQFZRTG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|