C32H35N5O6 — CID 175306349
[4-methyl-2-[[(2S)-1-oxo-1-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]propan-2-yl]carbamoyl]phenyl] pyrrolidine-1-carboxylate (PubChem CID 175306349) has the molecular formula C32H35N5O6 and a molecular weight of 585.66 g/mol. Its IUPAC name is [4-methyl-2-[[(2S)-1-oxo-1-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]propan-2-yl]carbamoyl]phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [4-methyl-2-[[(2S)-1-oxo-1-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]propan-2-yl]carbamoyl]phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175306349 |
| Molecular Formula | C32H35N5O6 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | [4-methyl-2-[[(2S)-1-oxo-1-[[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]propan-2-yl]carbamoyl]phenyl] pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(CNC(=O)[C@H](C)NC(=O)c2cc(C)ccc2OC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C32H35N5O6/c1-21-10-15-27(43-32(41)37-16-6-7-17-37)26(18-21)30(39)35-22(2)29(38)34-19-23-11-13-25(14-12-23)28(33)36-31(40)42-20-24-8-4-3-5-9-24/h3-5,8-15,18,22H,6-7,16-17,19-20H2,1-2H3,(H,34,38)(H,35,39)(H2,33,36,40)/t22-/m0/s1 |
| InChIKey | VMLODVYFAVTPAG-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|