C35H39N3O9 — CID 173363266
1-ethoxycarbonyloxyethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 173363266) has the molecular formula C35H39N3O9 and a molecular weight of 645.71 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173363266 |
| Molecular Formula | C35H39N3O9 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(-c2ccc(OC)c(C(=O)NC3CCC(C(=O)OC(C)OC(=O)OCC)CC3)c2)cc1 |
| InChI | InChI=1S/C35H39N3O9/c1-4-44-35(42)47-22(2)46-33(40)26-14-17-28(18-15-26)37-32(39)29-20-27(16-19-30(29)43-3)24-10-12-25(13-11-24)31(36)38-34(41)45-21-23-8-6-5-7-9-23/h5-13,16,19-20,22,26,28H,4,14-15,17-18,21H2,1-3H3,(H,37,39)(H2,36,38,41) |
| InChIKey | ASWVDTTUDGDHGD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|