C36H41N3O8 — CID 173363271
2,2-dimethylpropanoyloxymethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 173363271) has the molecular formula C36H41N3O8 and a molecular weight of 643.74 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173363271 |
| Molecular Formula | C36H41N3O8 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 4-[[2-methoxy-5-[4-(N-phenylmethoxycarbonylcarbamimidoyl)phenyl]benzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)c1ccc(-c2ccc(OC)c(C(=O)NC3CCC(C(=O)OCOC(=O)C(C)(C)C)CC3)c2)cc1 |
| InChI | InChI=1S/C36H41N3O8/c1-36(2,3)34(42)47-22-46-33(41)26-14-17-28(18-15-26)38-32(40)29-20-27(16-19-30(29)44-4)24-10-12-25(13-11-24)31(37)39-35(43)45-21-23-8-6-5-7-9-23/h5-13,16,19-20,26,28H,14-15,17-18,21-22H2,1-4H3,(H,38,40)(H2,37,39,43) |
| InChIKey | VZNSCPKRMKBAEW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|