C28H25NO3S — CID 25131160
5-[3,4-bis(phenylmethoxy)phenyl]-N-cyclopropylthiophene-2-carboxamide (PubChem CID 25131160) has the molecular formula C28H25NO3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 5-[3,4-bis(phenylmethoxy)phenyl]-N-cyclopropylthiophene-2-carboxamide.
| Compound Name | 5-[3,4-bis(phenylmethoxy)phenyl]-N-cyclopropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 25131160 |
| Molecular Formula | C28H25NO3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 5-[3,4-bis(phenylmethoxy)phenyl]-N-cyclopropylthiophene-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(-c2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)s1 |
| InChI | InChI=1S/C28H25NO3S/c30-28(29-23-12-13-23)27-16-15-26(33-27)22-11-14-24(31-18-20-7-3-1-4-8-20)25(17-22)32-19-21-9-5-2-6-10-21/h1-11,14-17,23H,12-13,18-19H2,(H,29,30) |
| InChIKey | SHEPJOOJKBHISF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |