C20H16O6S — CID 91101504
2-[5-(3-hydroxy-4-phenylmethoxyphenyl)thiophene-2-carbonyl]oxyacetic acid (PubChem CID 91101504) has the molecular formula C20H16O6S and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[5-(3-hydroxy-4-phenylmethoxyphenyl)thiophene-2-carbonyl]oxyacetic acid.
| Compound Name | 2-[5-(3-hydroxy-4-phenylmethoxyphenyl)thiophene-2-carbonyl]oxyacetic acid |
|---|---|
| PubChem CID | 91101504 |
| Molecular Formula | C20H16O6S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[5-(3-hydroxy-4-phenylmethoxyphenyl)thiophene-2-carbonyl]oxyacetic acid |
| SMILES | O=C(O)COC(=O)c1ccc(-c2ccc(OCc3ccccc3)c(O)c2)s1 |
| InChI | InChI=1S/C20H16O6S/c21-15-10-14(6-7-16(15)25-11-13-4-2-1-3-5-13)17-8-9-18(27-17)20(24)26-12-19(22)23/h1-10,21H,11-12H2,(H,22,23) |
| InChIKey | ZBKOWPOUDPSTJI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |