C20H15BrO7S — CID 68835861
4-bromo-3-(carboxymethoxy)-5-(4-hydroxy-3-phenylmethoxyphenyl)thiophene-2-carboxylic acid (PubChem CID 68835861) has the molecular formula C20H15BrO7S and a molecular weight of 479.30 g/mol. Its IUPAC name is 4-bromo-3-(carboxymethoxy)-5-(4-hydroxy-3-phenylmethoxyphenyl)thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-3-(carboxymethoxy)-5-(4-hydroxy-3-phenylmethoxyphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68835861 |
| Molecular Formula | C20H15BrO7S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 4-bromo-3-(carboxymethoxy)-5-(4-hydroxy-3-phenylmethoxyphenyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc(-c2ccc(O)c(OCc3ccccc3)c2)c1Br |
| InChI | InChI=1S/C20H15BrO7S/c21-16-17(28-10-15(23)24)19(20(25)26)29-18(16)12-6-7-13(22)14(8-12)27-9-11-4-2-1-3-5-11/h1-8,22H,9-10H2,(H,23,24)(H,25,26) |
| InChIKey | BSUBHGBIKHYTHD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |