C17H13BrO8S — CID 68838625
4-bromo-5-[3-(2-carboxyethenyl)-4-methoxyphenyl]-3-(carboxymethoxy)thiophene-2-carboxylic acid (PubChem CID 68838625) has the molecular formula C17H13BrO8S and a molecular weight of 457.25 g/mol. Its IUPAC name is 4-bromo-5-[3-(2-carboxyethenyl)-4-methoxyphenyl]-3-(carboxymethoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-bromo-5-[3-(2-carboxyethenyl)-4-methoxyphenyl]-3-(carboxymethoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68838625 |
| Molecular Formula | C17H13BrO8S |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 4-bromo-5-[3-(2-carboxyethenyl)-4-methoxyphenyl]-3-(carboxymethoxy)thiophene-2-carboxylic acid |
| SMILES | COc1ccc(-c2sc(C(=O)O)c(OCC(=O)O)c2Br)cc1C=CC(=O)O |
| InChI | InChI=1S/C17H13BrO8S/c1-25-10-4-2-9(6-8(10)3-5-11(19)20)15-13(18)14(26-7-12(21)22)16(27-15)17(23)24/h2-6H,7H2,1H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | GYMSEQFYSXFNQB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|