C22H26O9 — CID 70284395
2-(2,5-dimethoxyphenyl)acetic acid;(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 70284395) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)acetic acid;(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)acetic acid;(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 70284395 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)acetic acid;(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)c(OC)c1OC.COc1ccc(OC)c(CC(=O)O)c1 |
| InChI | InChI=1S/C12H14O5.C10H12O4/c1-15-9-6-4-8(5-7-10(13)14)11(16-2)12(9)17-3;1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h4-7H,1-3H3,(H,13,14);3-5H,6H2,1-2H3,(H,11,12)/b7-5+; |
| InChIKey | JSJCITQGLCQJJK-GZOLSCHFSA-N |
| XLogP | 3.14 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|